Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> N-methyl-N-(piperidin-4-yl)acetamide hydrochloride
For research use only. Not for therapeutic Use.
N-methyl-N-(piperidine-4-yl)acetamide hydrochloride (Cat No.:L027358) is a chemical compound with a piperidine ring bearing a methyl group at the nitrogen atom and an acetamide group attached. The compound exists as a hydrochloride salt, with a chloride counterion. It may find applications in medicinal chemistry and pharmaceutical research due to its structural features and potential interactions with biological systems. The presence of the piperidine and acetamide groups adds specific chemical properties, making it relevant for drug design and synthesis.
CAS Number | 550370-51-9 |
Molecular Formula | C8H17ClN2O |
Purity | ≥95% |
IUPAC Name | N-methyl-N-piperidin-4-ylacetamide;hydrochloride |
InChI | InChI=1S/C8H16N2O.ClH/c1-7(11)10(2)8-3-5-9-6-4-8;/h8-9H,3-6H2,1-2H3;1H |
InChIKey | YLGIOTWTHLSHOZ-UHFFFAOYSA-N |
SMILES | CC(=O)N(C)C1CCNCC1.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |