For research use only. Not for therapeutic Use.
N-methyl Protoporphyrin IX is a transition state analog that potently inhibits protoporphyrin IX ferrochelatase (K<sub>i</sub> = 10 nM), blocking the terminal step of the heme biosynthetic pathway. It is used to study the effect of heme synthesis blockade in cell systems.
| Catalog Number | R066859 |
| CAS Number | 79236-56-9 |
| Synonyms | NMPP;N-methyl PPIX |
| Molecular Formula | C35H36N4O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17,22-pentamethyl-23H-porphyrin-2-yl]propanoic acid |
| InChI | InChI=1S/C35H36N4O4/c1-8-22-18(3)28-17-33-23(9-2)21(6)32(39(33)7)16-27-20(5)25(11-13-35(42)43)31(38-27)15-30-24(10-12-34(40)41)19(4)26(36-30)14-29(22)37-28/h8-9,14-17,37H,1-2,10-13H2,3-7H3,(H,40,41)(H,42,43) |
| InChIKey | PWQMZDDLPYUOLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC1=CC3=C(C(=C(N3)C=C4C(=C(C(=CC5=NC(=C2)C(=C5C)CCC(=O)O)N4C)C)C=C)C)C=C)CCC(=O)O |
| Reference | 1.Ortiz de Montellano, P.R.,Beilan, H.S. and Kunze, K.L. N-Methylprotoporphyrin IX: Chemical synthesis and identification as the green pigment produced by 3,5-diethoxycarbonyl-1,4-dihydrocollidine treatment. Proc. Natl. Acad. Sci. USA 78(3), 1490-1494 (19 |
