For research use only. Not for therapeutic Use.
N-Methylbenzylamine-d3(Cat No.:R049192)is a deuterated form of N-methylbenzylamine, a chemical compound often used as a reagent in scientific research. The “d3” designation indicates that three hydrogen atoms in the compound are replaced with the stable isotope deuterium (heavy hydrogen, 2H). This modification allows N-methylbenzylamine-d3 to be used in isotopic labeling studies, particularly in metabolic research or studies involving the tracking of molecular interactions. The deuterated version is useful in experiments requiring precise monitoring of metabolic pathways, as it provides distinct signals in techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy.
CAS Number | 122025-09-6 |
Synonyms | N-benzyl-1,1,1-trideuteriomethanamine |
Molecular Formula | C8H8D3N |
Purity | ≥95% |
IUPAC Name | N-benzyl-1,1,1-trideuteriomethanamine |
InChI | InChI=1S/C8H11N/c1-9-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3/i1D3 |
InChIKey | RIWRFSMVIUAEBX-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])NCC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |