For research use only. Not for therapeutic Use.
n-Methylbutan-2-amine(Cat No.:L006852), is an organic compound characterized by a butylamine structure with a methyl group on the second carbon. This chemical is used as a building block in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Its versatile reactivity allows it to participate in various chemical reactions, enabling the creation of complex molecules. Researchers and chemists utilize this compound to introduce specific functionalities, facilitating the design and synthesis of diverse organic compounds.
Catalog Number | L006852 |
CAS Number | 7713-69-1 |
Molecular Formula | C5H13N |
Purity | ≥95% |
IUPAC Name | N-methylbutan-2-amine |
InChI | InChI=1S/C5H13N/c1-4-5(2)6-3/h5-6H,4H2,1-3H3 |
InChIKey | PYFSCIWXNSXGNS-UHFFFAOYSA-N |
SMILES | CCC(C)NC |