For research use only. Not for therapeutic Use.
N-methylbutyramide(Cat No.:M078630) is an organic compound characterized by the presence of a butyramide backbone where the amide nitrogen is substituted with a methyl group. Its molecular formula is C5H11NO, combining elements of amides and simple hydrocarbons. This compound is primarily of interest in the field of organic chemistry for its utility as an intermediate in chemical synthesis. N-methylbutyramide’s structural simplicity and the presence of both an amide and a methyl group lend it useful properties for modifications, making it valuable for producing more complex molecules, particularly in pharmaceutical and agricultural chemical manufacturing.
CAS Number | 17794-44-4 |
Synonyms | N-Methylbutyramide |
Molecular Formula | C5H11NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-methylbutanamide |
InChI | InChI=1S/C5H11NO/c1-3-4-5(7)6-2/h3-4H2,1-2H3,(H,6,7) |
InChIKey | OLLZXQIFCRIRMH-UHFFFAOYSA-N |
SMILES | CCCC(=O)NC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |