For research use only. Not for therapeutic Use.
N-Methylcoclaurine is a naturally occurring alkaloid found in certain plant species, particularly those in the Papaveraceae and Ranunculaceae families. It is a benzylisoquinoline derivative and serves as a key intermediate in the biosynthesis of more complex alkaloids, such as morphine and codeine. N-Methylcoclaurine is known for its biological activity, including mild vasodilatory and anti-inflammatory effects. In research, it is studied for its potential pharmacological properties and its role in plant secondary metabolism, making it valuable in both botanical and pharmaceutical studies.
| Catalog Number | R053739 |
| CAS Number | 5096-70-8 |
| Synonyms | D-Methylcoclaurine; D-(-)-N-Methylcoclaurine |
| Molecular Formula | C18H21NO3 |
| Purity | 95% |
| Target | Disease Research Fields |
| Appearance | Solid powder |
| Storage | -20°C |
| Related CAS | 57256-02-7 |
| IUPAC Name | (1R)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-13-10-18(22-2)17(21)11-15(13)16(19)9-12-3-5-14(20)6-4-12/h3-6,10-11,16,20-21H,7-9H2,1-2H3/t16-/m1/s1 |
| InChIKey | BOKVLBSSPUTWLV-MRXNPFEDSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)O)O)OC |
