For research use only. Not for therapeutic Use.
N-Methyldibutylamine(Cat No.:R070706), is a chemical compound consisting of a butyl group (a four-carbon alkyl chain) attached to a secondary amine functional group, where one of the butyl carbons is also substituted with a methyl group (CH3). It is a clear, colorless liquid with applications in various industries. N-methyldibutylamine is used as a chemical intermediate in the synthesis of organic compounds, such as pharmaceuticals, agrochemicals, and surfactants.
CAS Number | 3405-45-6 |
Molecular Formula | C9H21N |
Purity | ≥95% |
Storage | RT |
IUPAC Name | N-butyl-N-methylbutan-1-amine |
InChI | InChI=1S/C9H21N/c1-4-6-8-10(3)9-7-5-2/h4-9H2,1-3H3 |
InChIKey | MTHFROHDIWGWFD-UHFFFAOYSA-N |
SMILES | CCCCN(C)CCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |