For research use only. Not for therapeutic Use.
N-Methylisatin-3-thiosemicarbazone(Cat No.:M121385)is a potent organic compound used in pharmaceutical and biochemical research, known for its biological activity as a metal chelator. This thiosemicarbazone derivative demonstrates significant interactions with transition metals like copper and iron, making it useful in studies of metal-related diseases and drug design. Its structure, featuring a methyl group attached to the isatin core, allows it to exhibit antimicrobial, anticancer, and antiviral properties. N-Methylisatin-3-thiosemicarbazone is particularly valuable in investigations into oxidative stress and enzyme inhibition, offering a versatile tool for therapeutic development.
CAS Number | 1910-68-5 |
Molecular Formula | C10H10N4OS |
Purity | ≥95% |
Target | SARS-CoV |
Storage | -20°C |
IUPAC Name | (2-hydroxy-1-methylindol-3-yl)iminothiourea |
InChI | InChI=1S/C10H10N4OS/c1-14-7-5-3-2-4-6(7)8(9(14)15)12-13-10(11)16/h2-5,15H,1H3,(H2,11,16) |
InChIKey | TTZUCVNWOZLIGL-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC=C2C(=C1O)N=NC(=S)N |