For research use only. Not for therapeutic Use.
N-[N’-FMoc-(2′-aminoethyl)]glycine(CAT: M137322) is a significant compound in the field of organic chemistry and peptide synthesis. This compound is often employed as a building block in the assembly of peptides and peptidomimetics for various research and pharmaceutical applications. The Fmoc (9-fluorenylmethoxycarbonyl) protecting group is commonly used in peptide synthesis to protect the amino group during chain elongation and can be selectively removed later.
Catalog Number | M137322 |
CAS Number | 172405-45-7 |
Molecular Formula | C19H20N2O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethylamino]acetic acid |
InChI | InChI=1S/C19H20N2O4/c22-18(23)11-20-9-10-21-19(24)25-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17,20H,9-12H2,(H,21,24)(H,22,23) |
InChIKey | SBRGQYMCIVBMQJ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCNCC(=O)O |