Home
>
Reference Standards> N-[[N-Methyl-N-[(2-isopropyl]-4-thiazolyl)methyl)amino]carbonyl-L-valine Carboxylic Acid
For research use only. Not for therapeutic Use.
N-[[N-Methyl-N-[(2-isopropyl)-4-thiazolyl)methyl)amino]carbonyl-L-valine Carboxylic Acid(Cat No.:R004104), is a complex chemical compound primarily associated with pharmaceutical research. It is commonly referred to as an intermediate in the synthesis of certain drugs, particularly in the creation of angiotensin-converting enzyme (ACE) inhibitors used to manage hypertension and heart-related conditions. This compound plays a crucial role in modifying and structurally enhancing the properties of drug molecules.
CAS Number | 154212-61-0 |
Synonyms | N-[[Methyl[[2-(1-methylethyl)-4-thiazolyl]methyl]amino]carbonyl]-L-valine |
Molecular Formula | C14H23N3O3S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2S)-3-methyl-2-[[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]amino]butanoic acid |
InChI | InChI=1S/C14H23N3O3S/c1-8(2)11(13(18)19)16-14(20)17(5)6-10-7-21-12(15-10)9(3)4/h7-9,11H,6H2,1-5H3,(H,16,20)(H,18,19)/t11-/m0/s1 |
InChIKey | OSQWRZICKAOBFA-NSHDSACASA-N |
SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)NC(C(C)C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |