For research use only. Not for therapeutic Use.
N-Nitroso Desloratadine(Cat No.:R047238), is a chemical compound derived from Desloratadine, an antihistamine used to relieve allergy symptoms. It is classified as a nitrosamine, a class of compounds that has raised concerns due to potential carcinogenicity. N-Nitroso Desloratadine is not a natural component of Desloratadine but can form as a result of nitrosation reactions.
Catalog Number | R047238 |
CAS Number | 1246819-22-6 |
Synonyms | 8-Chloro-6,11-dihydro-11-(1-nitroso-4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine; |
Molecular Formula | C19H18ClN3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 8-chloro-11-(1-nitrosopiperidin-4-ylidene)-5,6-dihydrobenzo[1,2]cyclohepta[2,4-b]pyridine |
InChI | InChI=1S/C19H18ClN3O/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-21-19(14)18(17)13-7-10-23(22-24)11-8-13/h1-2,5-6,9,12H,3-4,7-8,10-11H2 |
InChIKey | BLGRQBLVAJWKOT-UHFFFAOYSA-N |
SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCN(CC3)N=O)C4=C1C=CC=N4 |