For research use only. Not for therapeutic Use.
N-Nitroso-N, N-di-(7-methyloctyl)amine(Cat No.:R012611), is a chemical compound belonging to the nitrosamine family. Nitrosamines are a group of organic compounds known to be potentially carcinogenic. This particular compound consists of two 7-methyloctyl groups attached to a central nitrogen atom with a nitroso functional group (N=NO) bonded to it. Nitrosamines can form in various industrial processes and are often regulated and monitored due to their potential health risks.
Catalog Number | R012611 |
CAS Number | 643014-99-7 |
Synonyms | N-Isononyl-N-nitrosoisononanamine; N-Nitrosodiisononylamine; |
Molecular Formula | C18H38N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N,N-bis(7-methyloctyl)nitrous amide |
InChI | InChI=1S/C18H38N2O/c1-17(2)13-9-5-7-11-15-20(19-21)16-12-8-6-10-14-18(3)4/h17-18H,5-16H2,1-4H3 |
InChIKey | XAYFTZOFOLGWAE-UHFFFAOYSA-N |
SMILES | CC(C)CCCCCCN(CCCCCCC(C)C)N=O |