For research use only. Not for therapeutic Use.
N-Nitrosoanatabine-d4(CAT: R054762) is a deuterium-labeled derivative of N-Nitrosoanatabine, a nitrosamine compound commonly found in tobacco and environmental carcinogen studies. As a stable isotope-labeled analog, it is primarily used in analytical research, including mass spectrometry-based detection of nitrosamine exposure and metabolic profiling. Given its relevance in studying carcinogenic compounds, this molecule is most closely associated with Cancer Disease Research, particularly in understanding nitrosamine-induced DNA damage and cancer risk assessment. It plays a critical role in biomonitoring studies, aiding in the detection and quantification of nitrosamine exposure to evaluate potential links to oncogenesis.
| Catalog Number | R054762 |
| CAS Number | 1020719-69-0 |
| Synonyms | 2,3,4,6-tetradeuterio-5-(1-nitroso-3,6-dihydro-2H-pyridin-2-yl)pyridine |
| Molecular Formula | C10H7D4N3O |
| Purity | ≥95% |
| IUPAC Name | 2,3,4,6-tetradeuterio-5-(1-nitroso-3,6-dihydro-2H-pyridin-2-yl)pyridine |
| InChI | InChI=1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2/i3D,4D,6D,8D |
| InChIKey | ZJOFAFWTOKDIFH-AJEVBKBKSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CC=CCN2N=O)[2H] |
