For research use only. Not for therapeutic Use.
N-Nitrosodimethylamine-d6 is a deuterated form of N-nitrosodimethylamine, with six hydrogen atoms replaced by deuterium. This compound is used as an internal standard in analytical chemistry, particularly in mass spectrometry, to accurately quantify and track N-nitrosodimethylamine in various samples. The deuterium labeling allows for precise differentiation from the non-labeled compound, facilitating studies on its presence, distribution, and metabolism. N-Nitrosodimethylamine-d6 is valuable in toxicology and cancer research due to N-nitrosodimethylamine’s role as a potent carcinogen, aiding in understanding its metabolic pathways and potential health risks.
CAS Number | 17829-05-9 |
Synonyms | N-Nitrosodi-N-methylamine-d6; Dimethylnitrosamine-d6; NDMA-d6; NSC 23226-d6; |
Molecular Formula | C2H6N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N,N-bis(trideuteriomethyl)nitrous amide |
InChI | InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3/i1D3,2D3 |
InChIKey | UMFJAHHVKNCGLG-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])N=O |