For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">N-Nitrosodipropylamine (CAS 621-64-7) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">may be used as an analytical reference standard for the determination of the analyte in wastewater samples gas chromatography—triple quadrupole mass spectrometry. It is considered as water contaminant.</span></span></span></span>
| Catalog Number | R050757 |
| CAS Number | 621-64-7 |
| Synonyms | N-Nitroso-N-propyl-1-propanamine; N,N-Dipropylnitrosamine; N-Nitroso-N-di-n-propylamine; N-Nitrosodi-n-propylamine; N-Nitrosodipropylamine; NSC 133; |
| Molecular Formula | C6H14N2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N,N-dipropylnitrous amide |
| InChI | InChI=1S/C6H14N2O/c1-3-5-8(7-9)6-4-2/h3-6H2,1-2H3 |
| InChIKey | YLKFDHTUAUWZPQ-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)N=O |
| Reference | <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Yoon, Suchul, Norihide Nakada, and Hiroaki Tanaka. "A new method for quantifying N-nitrosamines in wastewater samples by gas chromatography—triple quadrupole mass spectrometry." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Talanta</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 97 (2012): 256-261.<br /> |
