For research use only. Not for therapeutic Use.
N-octyl-D-gluconamide（Cat No.:M081811） is a non-ionic surfactant derived from natural sugars and a fatty acid chain. This compound combines an eight-carbon octyl group with a gluconamide moiety, the latter being a derivative of gluconic acid linked to an amine group. This structure grants it excellent solubility and gentle cleansing properties, making it popular in personal care and cosmetic formulations such as shampoos and skin cleansers. N-octyl-D-gluconamide is valued for its mildness, biodegradability, and effectiveness at stabilizing emulsions, reducing irritancy compared to more harsh surfactants, and enhancing product texture and feel.
| Catalog Number | M081811 |
| CAS Number | 18375-61-6 |
| Molecular Formula | C14H29NO6 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-octylhexanamide |
| InChI | InChI=1S/C14H29NO6/c1-2-3-4-5-6-7-8-15-14(21)13(20)12(19)11(18)10(17)9-16/h10-13,16-20H,2-9H2,1H3,(H,15,21)/t10-,11-,12+,13-/m1/s1 |
| InChIKey | KTMBZDQOFPBYBL-FVCCEPFGSA-N |
| SMILES | CCCCCCCCNC(=O)C(C(C(C(CO)O)O)O)O |
| Reference | 1: Muster TH, Prestidge CA. Water adsorption kinetics and contact angles of <br> |
