For research use only. Not for therapeutic Use.
N-<wbr></wbr>Oleoyl glycine is a putative substrate for peptidyl glycine α-<wbr></wbr>amidating enzyme in the biosynthesis of oleoyl amide.
| Catalog Number | R067712 |
| CAS Number | 2601-90-3 |
| Synonyms | N-(9Z-octadecenoyl)-glycine |
| Molecular Formula | C20H37NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 2-[[(Z)-octadec-9-enoyl]amino]acetic acid |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h9-10H,2-8,11-18H2,1H3,(H,21,22)(H,23,24)/b10-9- |
| InChIKey | HPFXACZRFJDURI-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NCC(=O)O |
| Reference | 1.Merkler, D.J.,Merkler, K.A.,Stern, W., et al. Fatty acid amide biosynthesis: A possible role for peptidylglycine α-amidating enzyme and acyl-coenzyme A:glycine N-acyltransferase. Archives of Biochemistry and Biophysics 330, 430-434 (1996). |
