For research use only. Not for therapeutic Use.
Bone mass and shape is continuously remodeled by the concerted and balanced action of osteoblasts (bone forming cells) and osteoclasts (bone-<wbr></wbr>resorbing cells). The endocannabinoid system plays an essential role in the maintenance of normal bone mass <em>via</em> signaling through the CB<sub>2</sub> receptor. N-<wbr></wbr>Oleoyl-<wbr></wbr>L-<wbr></wbr>serine is an endogenous lipid that has been reported to stimulate bone formation and to inhibit bone resorption.
| Catalog Number | R063618 |
| CAS Number | 107743-37-3 |
| Synonyms | (S)-3-hydroxy-2-oleamidopropanoic acid |
| Molecular Formula | C21H39NO4 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| InChI | InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22-19(18-23)21(25)26/h9-10,19,23H,2-8,11-18H2,1H3,(H,22,24)(H,25,26)/b10-9- |
| InChIKey | MBDKGXAMSZIDKF-KTKRTIGZSA-N |
| SMILES | CCCCCCCC/C=CCCCCCCCC(N[C@H](C(O)=O)CO)=O |
| Reference | 1.Bab, I., and Zimmer, A. Cannabinoid receptors and the regulation of bone mass. British Journal of Pharmacology 153, 182-188 (2008). |
