For research use only. Not for therapeutic Use.
N-Phenylpropanamide(Cat No.:R052296), is an organic compound often referred to as phenylpropionamide. It features a phenyl group attached to the amide functional group within a three-carbon propanamide chain. This compound finds applications in both the pharmaceutical and chemical industries. In the pharmaceutical sector, it serves as a precursor in the synthesis of various drugs and pharmaceutical intermediates. In the chemical industry, it can be used as a building block for the production of specialty chemicals, including those used in the manufacturing of polymers, fragrances, and agrochemicals. N-Phenylpropanamide’s versatile chemical structure makes it valuable in diverse synthetic processes.
CAS Number | 620-71-3 |
Synonyms | Propionanilide; N-Phenylpropionamide; NSC 58952; R 50977; |
Molecular Formula | C9H11NO |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | N-phenylpropanamide |
InChI | InChI=1S/C9H11NO/c1-2-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
InChIKey | ZTHRQJQJODGZHV-UHFFFAOYSA-N |
SMILES | CCC(=O)NC1=CC=CC=C1 |