For research use only. Not for therapeutic Use.
N-propionyl-d5-glycine(Cat No.:S000706) is a deuterated form of N-propionyl-glycine, where five hydrogen atoms are replaced with deuterium, increasing its molecular stability and making it highly suitable as an internal standard for precise analytical methods such as mass spectrometry and NMR spectroscopy. N-Propionyl-glycine is a modified amino acid used in biochemical studies to explore metabolism and enzyme function. The incorporation of deuterium into N-Propionyl-d5-glycine allows for more accurate pharmacokinetic and metabolic research, providing clearer insights into how this compound is processed and utilized in biological systems, and enhancing our understanding of its biochemical roles.
Catalog Number | S000706 |
Molecular Formula | C5H4D5NO3 |
Purity | ≥95% |
IUPAC Name | 2-(2,2,3,3,3-pentadeuteriopropanoylamino)acetic acid |
InChI | InChI=1S/C5H9NO3/c1-2-4(7)6-3-5(8)9/h2-3H2,1H3,(H,6,7)(H,8,9)/i1D3,2D2 |
InChIKey | WOMAZEJKVZLLFE-ZBJDZAJPSA-N |
SMILES | CCC(=O)NCC(=O)O |