For research use only. Not for therapeutic Use.
N-Salicyloyltryptamine(Cat No.:I042926)is a tryptamine derivative that inhibits voltage-dependent Na⁺, Ca²⁺, and K⁺ ion channels, with an IC₅₀ of 34.6 μM for K⁺ currents. It exhibits anticonvulsant properties, reducing seizure incidence in animal models. Additionally, it demonstrates anti-inflammatory and analgesic effects by inhibiting pro-inflammatory cytokines like TNF-α and IL-1β, and modulating NF-κB signaling. N-Salicyloyltryptamine also induces vasorelaxation through activation of the NO/sGC/cGMP pathway and reduction of calcium influx, contributing to its therapeutic potential in cardiovascular conditions.
CAS Number | 31384-98-2 |
Synonyms | 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
Molecular Formula | C17H16N2O2 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
InChI | InChI=1S/C17H16N2O2/c20-16-8-4-2-6-14(16)17(21)18-10-9-12-11-19-15-7-3-1-5-13(12)15/h1-8,11,19-20H,9-10H2,(H,18,21) |
InChIKey | XBPYTDZHCNJRBY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C3=CC=CC=C3O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |