For research use only. Not for therapeutic Use.
N-Succinimidyl 4-Azido-2,3,5,6-tetrafluorobenzoate (Cat.No:R000862) is a chemical compound used in bioconjugation and labeling experiments. It functions as a versatile reagent for attaching azide groups to biomolecules, enabling subsequent bioorthogonal click reactions. Its unique properties make it valuable in diverse research applications, such as protein and nucleic acid labeling in biotechnology and chemical biology.
CAS Number | 126695-58-7 |
Synonyms | 4-Azido-2,3,5,6-tetrafluorobenzoic Acid, N-Succinimidyl Ester, ATFB SE |
Molecular Formula | C11H4F4N4O4 |
Purity | ≥95% |
Target | ADC Linker |
Storage | Store at -20C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-azido-2,3,5,6-tetrafluorobenzoate |
InChI | InChI=1S/C11H4F4N4O4/c12-6-5(7(13)9(15)10(8(6)14)17-18-16)11(22)23-19-3(20)1-2-4(19)21/h1-2H2 |
InChIKey | HCTLWQSYGIBOFM-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C(C(=C(C(=C2F)F)N=[N+]=[N-])F)F |