For research use only. Not for therapeutic Use.
N-Succinyl-Ala-Phe-Lys 7-amido-4-methylcoumarin acetate salt(Cat No.:M024156) is a synthetic peptide used primarily as a substrate in enzymatic assays to measure protease activity, particularly trypsin-like enzymes. The compound features a peptide sequence linked to a 7-amido-4-methylcoumarin (AMC) moiety, which acts as a fluorescent reporter. Upon enzymatic cleavage, AMC is released, emitting fluorescence that can be quantitatively measured. This characteristic makes it valuable in biochemical studies for assessing enzyme kinetics and activity. The acetate salt form enhances its solubility, facilitating its use in various research applications.
Catalog Number | M024156 |
CAS Number | 117756-27-1 |
Molecular Formula | C34H43N5O10 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | acetic acid;4-[[(2S)-1-[[(2S)-1-[[(2S)-6-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
InChI | InChI=1S/C32H39N5O8.C2H4O2/c1-19-16-29(41)45-26-18-22(11-12-23(19)26)35-31(43)24(10-6-7-15-33)36-32(44)25(17-21-8-4-3-5-9-21)37-30(42)20(2)34-27(38)13-14-28(39)40;1-2(3)4/h3-5,8-9,11-12,16,18,20,24-25H,6-7,10,13-15,17,33H2,1-2H3,(H,34,38)(H,35,43)(H,36,44)(H,37,42)(H,39,40);1H3,(H,3,4)/t20-,24-,25-;/m0./s1 |
InChIKey | YSFJDCMZVSMICC-FMQWQMCSSA-N |
SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(CCCCN)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(C)NC(=O)CCC(=O)O.CC(=O)O |