For research use only. Not for therapeutic Use.
N-(Trimethylsilyl)-2-[(trimethylsilyl)oxy]pyrimidin-4-amine(Cat No.:M084502) is a chemically modified pyrimidine derivative extensively used in the synthesis of pharmaceuticals and agricultural chemicals. Featuring two trimethylsilyl groups, this compound enhances the stability and reactivity of the pyrimidine ring, making it a valuable intermediate in organic synthesis. The presence of the amino group and the silyl ether functionality allows for selective reactions, particularly in the development of nucleoside analogs, which are crucial in antiviral and anticancer drugs. Its applications in synthesizing more complex molecules underscore its importance in medicinal chemistry and drug development processes.
CAS Number | 18037-10-0 |
Molecular Formula | C10H21N3OSi2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | N-trimethylsilyl-2-trimethylsilyloxypyrimidin-4-amine |
InChI | InChI=1S/C10H21N3OSi2/c1-15(2,3)13-9-7-8-11-10(12-9)14-16(4,5)6/h7-8H,1-6H3,(H,11,12,13) |
InChIKey | IWEHUWMQLZFGLL-UHFFFAOYSA-N |
SMILES | C[Si](C)(C)NC1=NC(=NC=C1)O[Si](C)(C)C |