N1-Methylpseudouridine-5′-triphosphate(CAT: R015369) is a modified nucleotide used in the synthesis of RNA, particularly in mRNA therapeutics and vaccine development. This modification enhances the stability and translational efficiency of mRNA while reducing immune recognition, making it a key component in optimizing the performance of mRNA-based vaccines, such as those for COVID-19. The N1-methyl modification on pseudouridine confers improved resistance to nucleases and minimizes inflammatory responses, promoting higher protein expression levels in cells. Its applications in pharmaceutical research focus on enhancing the therapeutic potential and safety of mRNA therapies.
| Catalog Number | R015369 |
| CAS Number | 1428903-59-6 |
| Synonyms | N1-Methylpseudo-UTP; N1-Methylpseudouridine-5′-triphosphate, Sodium Salt |
| Molecular Formula | C10H17N2O15P3(free acid) |
| Purity | 95% |
| Appearance | colorless to slightly yellow solutin in water |
| Analysis method | HPLC |
| IUPAC Name | [[3,4-dihydroxy-5-(1-methyl-2,4-dioxopyrimidin-5-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChI | InChI=1S/C10H17N2O15P3/c1-12-2-4(9(15)11-10(12)16)8-7(14)6(13)5(25-8)3-24-29(20,21)27-30(22,23)26-28(17,18)19/h2,5-8,13-14H,3H2,1H3,(H,20,21)(H,22,23)(H,11,15,16)(H2,17,18,19) |
| InChIKey | OLRONOIBERDKRE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |
