For research use only. Not for therapeutic Use.
N10-Trifluoroacetylpteroic Acid (Cat.No:R023815) is a chemical compound often used as a key intermediate in the synthesis of folate analogs. It plays a crucial role in the development of pharmaceuticals, particularly antifolate drugs used in cancer treatment and antimicrobial agents.
Catalog Number | R023815 |
CAS Number | 37793-53-6 |
Synonyms | 4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl](2,2,2-trifluoroacetyl)amino]benzoic Acid; 4-[[(2-Amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl](trifluoroacetyl)amino]benzoic Acid |
Molecular Formula | C16H11F3N6O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-[(2-amino-4-oxo-1H-pteridin-6-yl)methyl-(2,2,2-trifluoroacetyl)amino]benzoic acid |
InChI | InChI=1S/C16H11F3N6O4/c17-16(18,19)14(29)25(9-3-1-7(2-4-9)13(27)28)6-8-5-21-11-10(22-8)12(26)24-15(20)23-11/h1-5H,6H2,(H,27,28)(H3,20,21,23,24,26) |
InChIKey | IJGIHDXKYQLIMA-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)O)N(CC2=CN=C3C(=N2)C(=O)N=C(N3)N)C(=O)C(F)(F)F |