For research use only. Not for therapeutic Use.
N,2-dimethyl-1,3-thiazole-5-carboxamide(Cat No.:L007597), is a chemical compound featuring a thiazole ring substituted with two methyl groups at the N-position and a carboxamide group at the 5-position. This unique molecular structure is significant in organic synthesis and medicinal chemistry. Researchers employ it as a building block in the creation of diverse organic molecules, particularly in drug discovery. Its thiazole core and amide functional group provide opportunities for chemical modifications, enabling the development of new compounds with potential biological activities.
CAS Number | 1235439-10-7 |
Molecular Formula | C6H8N2OS |
Purity | ≥95% |
IUPAC Name | N,2-dimethyl-1,3-thiazole-5-carboxamide |
InChI | InChI=1S/C6H8N2OS/c1-4-8-3-5(10-4)6(9)7-2/h3H,1-2H3,(H,7,9) |
InChIKey | PUIJVJNJITYIIM-UHFFFAOYSA-N |
SMILES | CC1=NC=C(S1)C(=O)NC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |