For research use only. Not for therapeutic Use.
N2-Phenylacetyl guanosine(Cat No.:M113286)is a modified nucleoside, where the guanosine base is conjugated with a phenylacetyl group. This modification can influence the compound’s biological activity, potentially enhancing its stability and interaction with cellular targets. Researchers often explore its role in various biochemical pathways, especially in relation to nucleoside analogs in medicinal chemistry. The phenylacetyl moiety may contribute to improved pharmacokinetics and therapeutic efficacy, making it a compound of interest in drug development. Understanding its mechanism can ultimately lead to innovative treatments in disease management.
Catalog Number | M113286 |
CAS Number | 132628-16-1 |
Molecular Formula | C18H19N5O6 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-phenylacetamide |
InChI | InChI=1S/C18H19N5O6/c24-7-10-13(26)14(27)17(29-10)23-8-19-12-15(23)21-18(22-16(12)28)20-11(25)6-9-4-2-1-3-5-9/h1-5,8,10,13-14,17,24,26-27H,6-7H2,(H2,20,21,22,25,28)/t10-,13-,14-,17-/m1/s1 |
InChIKey | IRSCBAKCFOLZNC-IWCJZZDYSA-N |
SMILES | C1=CC=C(C=C1)CC(=O)NC2=NC3=C(C(=O)N2)N=CN3[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |