For research use only. Not for therapeutic Use.
N3-Cho (Azido-choline) bromide is a click chemistry reagent containing an azide group that can be used in the synthesis of cell membrane structures[1].
| Catalog Number | I040056 |
| CAS Number | 2059973-54-3 |
| Synonyms | 2-azidoethyl-(2-hydroxyethyl)-dimethylazanium;bromide |
| Molecular Formula | C6H15BrN4O |
| Purity | ≥95% |
| InChI | InChI=1S/C6H15N4O.BrH/c1-10(2,5-6-11)4-3-8-9-7;/h11H,3-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JEEONNZALWOYMM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CCN=[N+]=[N-])CCO.[Br-] |
| Reference | [1]. Masaki Tsuchiya, et al. Organelle-selective click labeling coupled with flow cytometry allows pooled CRISPR screening of genes involved in phosphatidylcholine metabolism. Cell Metab. 2023 Jun 6;35(6):1072-1083.e9. |
