For research use only. Not for therapeutic Use.
N3-Cho Bromide (Cat No.: I040056) is a chemical compound used in synthesis chemistry and biomedical research. As a choline derivative, it plays a role in studying cellular metabolism, neurotransmitter function, and lipid signaling pathways. Its bromide form enhances solubility, making it suitable for in vitro and biochemical assays. N3-Cho Bromide is particularly useful in neurological disease research, investigating choline metabolism, and exploring potential therapeutic applications. Additionally, it serves as a key reagent in organic synthesis and drug discovery efforts.
CAS Number | 2059973-54-3 |
Synonyms | 2-azidoethyl-(2-hydroxyethyl)-dimethylazanium;bromide |
Molecular Formula | C6H15BrN4O |
Purity | ≥95% |
InChI | InChI=1S/C6H15N4O.BrH/c1-10(2,5-6-11)4-3-8-9-7;/h11H,3-6H2,1-2H3;1H/q+1;/p-1 |
InChIKey | JEEONNZALWOYMM-UHFFFAOYSA-M |
SMILES | C[N+](C)(CCN=[N+]=[N-])CCO.[Br-] |
Reference | [1]. Masaki Tsuchiya, et al. Organelle-selective click labeling coupled with flow cytometry allows pooled CRISPR screening of genes involved in phosphatidylcholine metabolism. Cell Metab. 2023 Jun 6;35(6):1072-1083.e9. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |