For research use only. Not for therapeutic Use.
N,3-Dimethylcyclohexanamine hydrochloride(Cat No.:L006992), is an organic compound used in chemical research and organic synthesis. It is a derivative of cyclohexylamine, containing two methyl groups attached to the cyclohexane ring, and it exists as a hydrochloride salt. This compound is employed as a building block in the development of various complex organic molecules, including pharmaceuticals and agrochemicals. Its specific structure provides unique reactivity, enabling its use in the creation of diverse functionalized compounds.
CAS Number | 854427-44-4 |
Molecular Formula | C8H18ClN |
Purity | ≥95% |
IUPAC Name | N,3-dimethylcyclohexan-1-amine;hydrochloride |
InChI | InChI=1S/C8H17N.ClH/c1-7-4-3-5-8(6-7)9-2;/h7-9H,3-6H2,1-2H3;1H |
InChIKey | AIQOLFRXKSYEQY-UHFFFAOYSA-N |
SMILES | CC1CCCC(C1)NC.Cl |