For research use only. Not for therapeutic Use.
N3-L-Val-OH (CHA)(Cat No.:R054969)is a modified amino acid derivative in which L-valine, a branched-chain amino acid, is conjugated with a cyano group (CHA) at the N3 position. This modification enhances the compound’s stability and reactivity, making it useful in bioorganic and medicinal chemistry research. N3-L-Val-OH (CHA) is typically studied for its role in peptide synthesis, protein interactions, and as a precursor for creating novel bioactive molecules. Its ability to form stable chemical bonds with other biomolecules makes it valuable in drug design, especially for targeting specific enzymes or receptors.
CAS Number | 1217462-63-9 |
Synonyms | (2S)-2-azido-3-methylbutanoic acid;cyclohexanamine |
Molecular Formula | C11H22N4O2 |
Purity | ≥95% |
IUPAC Name | (2S)-2-azido-3-methylbutanoic acid;cyclohexanamine |
InChI | InChI=1S/C6H13N.C5H9N3O2/c7-6-4-2-1-3-5-6;1-3(2)4(5(9)10)7-8-6/h6H,1-5,7H2;3-4H,1-2H3,(H,9,10)/t;4-/m.0/s1 |
InChIKey | YMXXCNHHCIMTCV-VWMHFEHESA-N |
SMILES | CC(C)[C@@H](C(=O)O)N=[N+]=[N-].C1CCC(CC1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |