For research use only. Not for therapeutic Use.
N3-PEG3-CH2CH2COOH (Cat.No:I017200) is a chemical compound used in bioconjugation and drug delivery applications. It consists of a polyethylene glycol (PEG) linker with a carboxylic acid functional group at one end and an azide group at the other end. The azide group allows for further modification through click chemistry reactions, enabling the attachment of various molecules for targeted drug delivery or bioconjugation purposes.
| Catalog Number | I017200 |
| CAS Number | 1056024-94-2 |
| Molecular Formula | C₉H₁₇N₃O₅ |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C9H17N3O5/c10-12-11-2-4-16-6-8-17-7-5-15-3-1-9(13)14/h1-8H2,(H,13,14) |
| InChIKey | VWJGWKZZFZMGGY-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCN=[N+]=[N-])C(=O)O |
| Reference | [1]. Popow J, et al. Highly Selective PTK2 Proteolysis Targeting Chimeras to Probe Focal Adhesion Kinase Scaffolding Functions. J Med Chem. 2019 Mar 14;62(5):2508-2520. |
