For research use only. Not for therapeutic Use.
N33-TEG-COOH (Cat.No:I020240) is a chemical compound with a molecular structure that includes a 33-carbon alkyl chain and a carboxylic acid functional group. It is commonly used as a building block or linker in organic synthesis and drug discovery research. The presence of a polyethylene glycol (TEG) moiety provides solubility and flexibility to the compound, making it suitable for various applications in the field of chemistry and biotechnology.
| Catalog Number | I020240 |
| CAS Number | 201467-81-4 |
| Molecular Formula | C₁₀H₁₉N₃O₆ |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| IUPAC Name | 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| InChI | InChI=1S/C10H19N3O6/c11-13-12-1-2-16-3-4-17-5-6-18-7-8-19-9-10(14)15/h1-9H2,(H,14,15) |
| InChIKey | YHTABJLSZLHRFV-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCC(=O)O)N=[N+]=[N-] |
| Reference | [1]. Zengerle M, et al. Selective Small Molecule Induced Degradation of the BET Bromodomain Protein BRD4. ACS Chem Biol. 2015 Aug 21;10(8):1770-7. |
