For research use only. Not for therapeutic Use.
N6-((3-(3-Methyl-3H-diazirin-3-yl)propoxy)carbonyl)-L-lysine (Cat.No:L003718) is a crucial compound in chemical biology and proteomics research. Its unique diazirinyl group enables photoaffinity labeling, allowing for precise protein-protein interaction studies. This compound serves as a valuable tool in elucidating complex cellular processes and drug discovery. Its specialized reactivity highlights its importance in advancing our understanding of biological systems and in the development of targeted therapeutics.
CAS Number | 2231405-65-3 |
Molecular Formula | C12H22N4O4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-6-[3-(3-methyldiazirin-3-yl)propoxycarbonylamino]hexanoic acid |
InChI | InChI=1S/C12H22N4O4/c1-12(15-16-12)6-4-8-20-11(19)14-7-3-2-5-9(13)10(17)18/h9H,2-8,13H2,1H3,(H,14,19)(H,17,18)/t9-/m0/s1 |
InChIKey | RZJVINTUKBDURT-VIFPVBQESA-N |
SMILES | CC1(N=N1)CCCOC(=O)NCCCC[C@@H](C(=O)O)N |