For research use only. Not for therapeutic Use.
N6-Benzoyladenosine(Cat No.:R072795)is a synthetic nucleoside analog of adenosine, featuring a benzoyl group at the N6 position. This modification enhances its stability and bioactivity, making it a valuable compound in biochemical research. N6-Benzoyladenosine is known to interact with adenosine receptors and can influence various cellular processes, including signal transduction and metabolism. Its potential applications extend to studying the roles of adenosine in physiological and pathological conditions, including cancer and neurodegenerative diseases. Ongoing research aims to evaluate its pharmacological properties and therapeutic potential in targeted treatments and drug development.
CAS Number | 4546-55-8 |
Molecular Formula | C17H17N5O5 |
Purity | ≥95% |
IUPAC Name | N-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]benzamide |
InChI | InChI=1S/C17H17N5O5/c23-6-10-12(24)13(25)17(27-10)22-8-20-11-14(18-7-19-15(11)22)21-16(26)9-4-2-1-3-5-9/h1-5,7-8,10,12-13,17,23-25H,6H2,(H,18,19,21,26)/t10-,12-,13-,17-/m1/s1 |
InChIKey | NZDWTKFDAUOODA-CNEMSGBDSA-N |
SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |