For research use only. Not for therapeutic Use.
N6-Benzyl Adenosine (Cat.No:R001645) is a modified form of adenosine, a nucleoside involved in various cellular processes. It has been studied for its potential pharmacological effects, including anti-inflammatory and anti-cancer properties. N6-Benzyl Adenosine’s unique structure makes it a valuable compound for exploring novel therapeutic interventions in biomedical research.
CAS Number | 4294-16-0 |
Synonyms | 6-Benzylaminopurine Riboside; N-(Phenylmethyl)adenosine; 6-(Benzylamino)-9-β-D-ribofuranosylpurine; 6-Benzyladenosine; NSC 70423; |
Molecular Formula | C17H19N5O4 |
Purity | ≥95% |
Target | GPCR/G Protein |
Storage | -20°C |
IUPAC Name | (2R,3R,4S,5R)-2-[6-(benzylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
InChI | InChI=1S/C17H19N5O4/c23-7-11-13(24)14(25)17(26-11)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-25H,6-7H2,(H,18,19,20)/t11-,13-,14-,17-/m1/s1 |
InChIKey | MRPKNNSABYPGBF-LSCFUAHRSA-N |
SMILES | C1=CC=C(C=C1)CNC2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O |