For research use only. Not for therapeutic Use.
N6-Cyclopentyladenosine (Cat No.:I010451) is a synthetic compound that acts as a selective agonist for the adenosine A1 receptor. By binding to and activating the adenosine A1 receptor, it triggers specific physiological responses. N6-Cyclopentyladenosine is widely used in pharmacological research to study the role of adenosine receptors in various processes such as neurotransmission, cardiovascular regulation, and inflammation.
| Catalog Number | I010451 |
| CAS Number | 41552-82-3 |
| Synonyms | Alternative Name: CPA |
| Molecular Formula | C15H21N5O4 |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | Soluble to 100 mM in 1eq. HCl |
| Storage | 2-8°C |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C15H21N5O4/c21-5-9-11(22)12(23)15(24-9)20-7-18-10-13(16-6-17-14(10)20)19-8-3-1-2-4-8/h6-9,11-12,15,21-23H,1-5H2,(H,16,17,19)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | SQMWSBKSHWARHU-SDBHATRESA-N |
| SMILES | C1CCC(C1)NC2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O |
