For research use only. Not for therapeutic Use.
N6-Methyl-dAphosphoramidite(Cat No.:L048009), is a chemical compound used in nucleotide synthesis for oligonucleotide and DNA research. It is a derivative of deoxyadenosine (dA) with a methyl group attached to the N6 position of the adenine base. As a phosphoramidite, it facilitates efficient coupling during solid-phase DNA synthesis, enabling the creation of modified oligonucleotides with specific functionalities. This compound is valuable for studying DNA structure, protein-DNA interactions, and gene regulation.
CAS Number | 105931-58-6 |
Molecular Formula | C41H50N7O6P |
Purity | ≥95% |
Target | DNA/RNA Synthesis |
Storage | 4°C, away from moisture and light |
IUPAC Name | 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[6-(methylamino)purin-9-yl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
InChI | InChI=1S/C41H50N7O6P/c1-28(2)48(29(3)4)55(52-23-11-22-42)54-35-24-37(47-27-46-38-39(43-5)44-26-45-40(38)47)53-36(35)25-51-41(30-12-9-8-10-13-30,31-14-18-33(49-6)19-15-31)32-16-20-34(50-7)21-17-32/h8-10,12-21,26-29,35-37H,11,23-25H2,1-7H3,(H,43,44,45)/t35-,36+,37+,55?/m0/s1 |
InChIKey | PTWRBAYAPDVZGR-JNTXQERPSA-N |
SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |