For research use only. Not for therapeutic Use.
N6,O2’-Dimethyladenosine is a modified nucleoside derived from adenosine, featuring methyl groups attached to the nitrogen at position 6 and the oxygen at position 2’. This compound is significant in RNA biology and epigenetics, as it plays a role in regulating gene expression and RNA stability. It is studied for its potential implications in cellular processes and disease mechanisms.
Catalog Number | R036504 |
CAS Number | 57817-83-1 |
Synonyms | N-Methyl-2’-O-methyladenosine; 2’-O-Methyl-6-methyladenosine; 6-Methyl-2’-O-methyladenosine; N6,2’-O-Dimethyladenosine; N6,O2’-Dimethyladenosine; N6-Methyl-2’-O-methyladenosine; |
Molecular Formula | C12H17N5O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2R,3R,4R,5R)-2-(hydroxymethyl)-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-3-ol |
InChI | InChI=1S/C12H17N5O4/c1-13-10-7-11(15-4-14-10)17(5-16-7)12-9(20-2)8(19)6(3-18)21-12/h4-6,8-9,12,18-19H,3H2,1-2H3,(H,13,14,15)/t6-,8-,9-,12-/m1/s1 |
InChIKey | GRYSXUXXBDSYRT-WOUKDFQISA-N |
SMILES | CNC1=NC=NC2=C1N=CN2C3C(C(C(O3)CO)O)OC |