For research use only. Not for therapeutic Use.
N7-(2-Hydroxyethyl-d4)adenine(Cat No.:R046268) is a deuterated derivative of adenine, featuring four deuterium atoms in the 2-hydroxyethyl group. This isotopic enrichment enhances its stability and detectability in biochemical assays, making it an excellent tool for studying nucleotide metabolism and DNA repair processes. By providing clearer insights into adenine’s interaction within nucleic acid structures and its role in cellular signaling, N7-(2-Hydroxyethyl-d4)adenine facilitates in-depth research into genetic regulation and cellular response mechanisms. It is essential for advancing our understanding of molecular biology and genetic engineering practices.
CAS Number | 1246818-44-9 |
Synonyms | 6-Amino-7H-purine-7-ethanol-d4; |
Molecular Formula | C7H9N5O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(6-aminopurin-7-yl)-1,1,2,2-tetradeuterioethanol |
InChI | InChI=1S/C7H9N5O/c8-6-5-7(10-3-9-6)11-4-12(5)1-2-13/h3-4,13H,1-2H2,(H2,8,9,10)/i1D2,2D2 |
InChIKey | XOMKQMGJBJAMCE-LNLMKGTHSA-N |
SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](CS1)N2C=C(C(=NC2=O)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |