For research use only. Not for therapeutic Use.
N,9-Diphenyl-9H-carbazol-2-amine(CAT: L000128) is a compound of significance in material chemistry and organic synthesis. It is used as a building block for the synthesis of organic electronic materials, particularly in the development of organic semiconductors and polymers. Its molecular structure is conducive to enhancing the electronic properties of materials, making it a valuable component in the creation of advanced materials used in electronic devices such as organic transistors, light-emitting diodes (OLEDs), and organic photovoltaics.
Catalog Number | L000128 |
CAS Number | 1427316-55-9 |
Molecular Formula | C24H18N2 |
Purity | ≥95% |
IUPAC Name | N,9-diphenylcarbazol-2-amine |
InChI | InChI=1S/C24H18N2/c1-3-9-18(10-4-1)25-19-15-16-22-21-13-7-8-14-23(21)26(24(22)17-19)20-11-5-2-6-12-20/h1-17,25H |
InChIKey | ZHVOQKHZCNGWET-UHFFFAOYSA-N |