For research use only. Not for therapeutic Use.
Nicotinamide adenine dinucleotide (NAD+)(Cat No.:A000315)is a vital coenzyme found in all living cells, playing a crucial role in energy metabolism and cellular function. It facilitates redox reactions, transferring electrons in metabolic pathways such as glycolysis, the Krebs cycle, and oxidative phosphorylation, thus generating ATP. NAD+ also participates in DNA repair, gene expression, and cell signaling through sirtuins and PARPs. Declining NAD+ levels are linked to aging and various diseases. Supplementing NAD+ can enhance cellular repair, improve metabolic health, and potentially extend lifespan, making it a focus of anti-aging and health research.
CAS Number | 53-84-9 |
Synonyms | NA |
Molecular Formula | C21H27N7O14P2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | 3 years -20C powder |
IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C21H27N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1-4,7-8,10-11,13-16,20-21,29-32H,5-6H2,(H5-,22,23,24,25,33,34,35,36,37)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
InChIKey | BAWFJGJZGIEFAR-NNYOXOHSSA-N |
SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O)C(=O)N |