For research use only. Not for therapeutic Use.
NADA-green is a fluorescent D-amino acid probe. NADA-green is efficiently incorporated into the peptidoglycan of diverse bacterial species peptidoglycan biosynthesis. NADA-green allows probing of bacterial growth with minimal perturbation[1].
Excitation maximum~ 450 nm; emission maximum~ 555 nm[1].
D-amino acids are known to modify and strengthen the peptidoglycan layer. Fluorescent D-amino acids (FDAAs) are efficiently incorporated into the peptidoglycan of diverse bacterial species at the sites of active peptidoglycan biosynthesis, allowing specific and covalent probing of bacterial growth with minimal perturbation[1].
| Catalog Number | I015307 |
| CAS Number | 2253733-11-6 |
| Synonyms | (2R)-2-amino-3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propanoic acid;hydrochloride |
| Molecular Formula | C9H10ClN5O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H9N5O5.ClH/c10-4(9(15)16)3-11-5-1-2-6(14(17)18)8-7(5)12-19-13-8;/h1-2,4,11H,3,10H2,(H,15,16);1H/t4-;/m1./s1 |
| InChIKey | NKFVSANWNYYLLB-PGMHMLKASA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NCC(C(=O)O)N.Cl |
| Reference | [1]. Kuru E, T et al. Synthesis of fluorescent D-amino acids and their use for probing peptidoglycan synthesis and bacterial growth in situ. Nat Protoc. 2015;10(1):33-52. |
