For research use only. Not for therapeutic Use.
Nadolol(CAT: R013469) is a non-selective beta-adrenergic blocker used to treat cardiovascular conditions such as hypertension, angina (chest pain), and arrhythmias. By blocking beta-1 and beta-2 receptors, Nadolol reduces the heart rate, decreases the heart’s oxygen demand, and lowers blood pressure, making it effective for controlling high blood pressure and preventing heart attacks. Unlike some beta-blockers, Nadolol has a long half-life, allowing for once-daily dosing. It is also used in treating migraines and controlling symptoms of anxiety. However, Nadolol should be used cautiously in individuals with respiratory conditions like asthma due to its non-selective action on beta receptors.
| Catalog Number | R013469 |
| CAS Number | 42200-33-9 |
| Synonyms | 5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| Molecular Formula | C17H27NO4 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3 |
| InChIKey | VWPOSFSPZNDTMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(COC1=CC=CC2=C1CC(C(C2)O)O)O |
