For research use only. Not for therapeutic Use.
NADP sodium salt(Cat No.:I000651), short for Nicotinamide adenine dinucleotide phosphate sodium salt, is a coenzyme present in various living organisms. It plays a crucial role in oxidation-reduction reactions as a key electron carrier. NADP sodium salt functions as a cofactor in several enzymatic reactions, particularly those involved in cellular metabolism and energy production. It facilitates the transfer of electrons during biochemical reactions, allowing for the conversion of substrates and the synthesis of essential molecules. NADP sodium salt’s wide distribution and participation in redox reactions highlight its importance in maintaining cellular function and overall biological processes.
CAS Number | 1184-16-3 |
Molecular Formula | C21H27N7NaO17P3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Solubility | 100 mg/ml in H2O |
Storage | Store at -20°C |
IUPAC Name | sodium;[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C21H28N7O17P3.Na/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32;/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39);/q;+1/p-1/t10-,11-,13-,14-,15-,16-,20-,21-;/m1./s1 |
InChIKey | JNUMDLCHLVUHFS-QYZPTAICSA-M |
SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)OP(=O)(O)O)O)O)O)C(=O)N.[Na+] |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |