For research use only. Not for therapeutic Use.
Nafamostat(Cat No.:I004959) is a potent serine protease inhibitor with broad-spectrum activity. It acts as an inhibitor of kallikrein, a serine protease involved in various physiological and pathological processes. Additionally, nafamostat inhibits blood coagulation by interfering with factors in the coagulation cascade. It has also shown potential as a complement inhibitor, inhibiting the activation of the complement system involved in immune responses. The multifunctional properties of nafamostat make it a valuable compound for research and therapeutic applications in conditions such as sepsis, pancreatitis, and inflammatory disorders.
CAS Number | 81525-10-2 |
Synonyms | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate |
Molecular Formula | C19H17N5O2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | 2–8 °C |
IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(diaminomethylideneamino)benzoate |
InChI | InChI=1S/C19H17N5O2/c20-17(21)14-2-1-13-10-16(8-5-12(13)9-14)26-18(25)11-3-6-15(7-4-11)24-19(22)23/h1-10H,(H3,20,21)(H4,22,23,24) |
InChIKey | MQQNFDZXWVTQEH-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=N)N)N=C(N)N |
Reference | <p style=/line-height:25px/> |