For research use only. Not for therapeutic Use.
NAG-thiazoline(Cat No.:R018410)is a synthetic compound that combines N-acetylglucosamine (NAG) with a thiazoline ring structure. It is designed to mimic the natural biochemical pathways involving NAG, which plays a crucial role in cell wall synthesis and cellular signaling. NAG-thiazoline has shown potential in modulating immune responses and inhibiting microbial growth, particularly in bacterial and fungal infections. Its structure may also enable interactions with specific enzymes involved in carbohydrate metabolism. Research into NAG-thiazoline is focused on its use as an antimicrobial and immunomodulatory agent, with potential applications in treating infections and inflammatory diseases.
CAS Number | 179030-22-9 |
Synonyms | (3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
Molecular Formula | C8H13NO4S |
Purity | ≥95% |
IUPAC Name | (3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
InChI | InChI=1S/C8H13NO4S/c1-3-9-5-7(12)6(11)4(2-10)13-8(5)14-3/h4-8,10-12H,2H2,1H3/t4-,5-,6-,7-,8-/m1/s1 |
InChIKey | DRHXTSWSUAJOJZ-FMDGEEDCSA-N |
SMILES | CC1=N[C@@H]2[C@H]([C@@H]([C@H](O[C@@H]2S1)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |