For research use only. Not for therapeutic Use.
Nalidixic Acid（Cat No.:A000918）is a synthetic antibiotic and the first of the quinolone class, effective primarily against gram-negative bacteria. It inhibits bacterial DNA gyrase, an enzyme critical for DNA replication, thus preventing bacterial growth. Commonly used in urinary tract infections, Nalidixic Acid is significant in research for studying DNA synthesis, bacterial resistance mechanisms, and the development of newer fluoroquinolones. Its historical importance and selective activity provide a foundation for investigating bacterial DNA targets, contributing to advancements in antimicrobial therapy and the understanding of quinolone resistance pathways.
| Catalog Number | A000918 |
| CAS Number | 389-08-2 |
| Synonyms | 389-08-2; Nalidixin; Nevigramon; Uronidix; Nalidixate |
| Molecular Formula | C12H12N2O3 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Storage | -20°C |
| IUPAC Name | 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChI | InChI=1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |
| InChIKey | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)O |
| Reference | 1: Xu J, Marsac R, Wei C, Wu F, Boily JF, Hanna K. Cobinding of Pharmaceutical <br> <br> 4: Loganathan R, Ganeshpandian M, Bhuvanesh NSP, Palaniandavar M, Muruganantham 5: Miladi H, Zmantar T, Kouidhi B, Chaabouni Y, Mahdouani K, Bakhrouf A, Chaieb 6: Patiño Y, Pilehvar S, Díaz E, Ordóñez S, De Wael K. Electrochemical reduction 7: Campioni F, Souza RA, Martins VV, Stehling EG, Bergamini AMM, Falcão JP. 8: Bergamini FR, Ribeiro MA, Miranda PC, Formiga AL, Corbi PP. A novel binuclear <br> <br> |
