For research use only. Not for therapeutic Use.
Fmoc-L-lysine hydrochloride(Cat No.:M111685), functioning as a biological preservative, can degrade into lysine, an essential amino acid in the human body, and is considered safe. It possesses broad-spectrum antibacterial properties, inhibiting gram-positive bacteria, fungi, and certain gram-negative bacteria. Fmoc-L-lysine hydrochloride’s antimicrobial activity makes it useful for various applications where preservation and inhibition of microbial growth are desired. Its safety profile, coupled with its antimicrobial efficacy, adds to its appeal for potential applications in the food industry, healthcare products, and other related fields.
CAS Number | 139262-23-0 |
Molecular Formula | C21H25ClN2O4 |
Purity | ≥95% |
Target | PROTAC |
Storage | Store at 2-8°C |
IUPAC Name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
InChI | InChI=1S/C21H24N2O4.ClH/c22-12-6-5-11-19(20(24)25)23-21(26)27-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18;/h1-4,7-10,18-19H,5-6,11-13,22H2,(H,23,26)(H,24,25);1H/t19-;/m0./s1 |
InChIKey | MVMZFAIUUXYFGY-FYZYNONXSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCCCN)C(=O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |