For research use only. Not for therapeutic Use.
Nα-Fmoc-Nδ-Boc-L-ornithine(Cat No.:M002566)is a protected form of the amino acid L-ornithine, used in peptide synthesis. The Fmoc (9-fluorenylmethyloxycarbonyl) group protects the α-amino group, while the Boc (tert-butyloxycarbonyl) group protects the δ-amino group. These protective groups prevent unwanted side reactions during the peptide assembly process, allowing for selective deprotection and coupling reactions. L-ornithine is a non-proteinogenic amino acid involved in the urea cycle and is commonly incorporated into synthetic peptides for research or therapeutic purposes. Its dual protection makes it suitable for complex, stepwise peptide synthesis.
CAS Number | 109425-55-0 |
Molecular Formula | C25H30N2O6 |
Purity | ≥95% |
Storage | Desiccate at 2-8°C |
IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
InChI | InChI=1S/C25H30N2O6/c1-25(2,3)33-23(30)26-14-8-13-21(22(28)29)27-24(31)32-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20-21H,8,13-15H2,1-3H3,(H,26,30)(H,27,31)(H,28,29)/t21-/m0/s1 |
InChIKey | JOOIZTMAHNLNHE-NRFANRHFSA-N |
SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |